C21H15FN4O5S2 — CID 170914636
[4-[(Z)-2-cyano-3-[(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-fluorobenzoate (PubChem CID 170914636) has the molecular formula C21H15FN4O5S2 and a molecular weight of 486.51 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-[(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-fluorobenzoate.
| Compound Name | [4-[(Z)-2-cyano-3-[(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 170914636 |
| Molecular Formula | C21H15FN4O5S2 |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | [4-[(Z)-2-cyano-3-[(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-fluorobenzoate |
| SMILES | CCS(=O)(=O)c1nnc(NC(=O)/C(C#N)=C\c2ccc(OC(=O)c3ccc(F)cc3)cc2)s1 |
| InChI | InChI=1S/C21H15FN4O5S2/c1-2-33(29,30)21-26-25-20(32-21)24-18(27)15(12-23)11-13-3-9-17(10-4-13)31-19(28)14-5-7-16(22)8-6-14/h3-11H,2H2,1H3,(H,24,25,27)/b15-11- |
| InChIKey | SPRJRSDNKFFTDI-PTNGSMBKSA-N |
| XLogP | 3.24 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|