C13H12N4O4S2 — CID 171332939
2-cyano-N-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)-3-(5-methylfuran-2-yl)prop-2-enamide (PubChem CID 171332939) has the molecular formula C13H12N4O4S2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-cyano-N-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)-3-(5-methylfuran-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-N-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)-3-(5-methylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171332939 |
| Molecular Formula | C13H12N4O4S2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-cyano-N-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)-3-(5-methylfuran-2-yl)prop-2-enamide |
| SMILES | CCS(=O)(=O)c1nnc(NC(=O)C(C#N)=Cc2ccc(C)o2)s1 |
| InChI | InChI=1S/C13H12N4O4S2/c1-3-23(19,20)13-17-16-12(22-13)15-11(18)9(7-14)6-10-5-4-8(2)21-10/h4-6H,3H2,1-2H3,(H,15,16,18) |
| InChIKey | NWDAWVLPNXBTQK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|