C17H11BrN4O4S2 — CID 170912814
(Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170912814) has the molecular formula C17H11BrN4O4S2 and a molecular weight of 479.34 g/mol. Its IUPAC name is (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170912814 |
| Molecular Formula | C17H11BrN4O4S2 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 477.94 |
| IUPAC Name | (Z)-3-[5-(4-bromophenyl)furan-2-yl]-2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1nnc(NC(=O)/C(C#N)=C\c2ccc(-c3ccc(Br)cc3)o2)s1 |
| InChI | InChI=1S/C17H11BrN4O4S2/c1-28(24,25)17-22-21-16(27-17)20-15(23)11(9-19)8-13-6-7-14(26-13)10-2-4-12(18)5-3-10/h2-8H,1H3,(H,20,21,23)/b11-8- |
| InChIKey | RIHKZVNZVNRTRU-FLIBITNWSA-N |
| XLogP | 3.51 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|