C24H15ClN4O4S — CID 170918788
methyl 4-[5-[(Z)-3-[[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 170918788) has the molecular formula C24H15ClN4O4S and a molecular weight of 490.93 g/mol. Its IUPAC name is methyl 4-[5-[(Z)-3-[[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(Z)-3-[[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 170918788 |
| Molecular Formula | C24H15ClN4O4S |
| Molecular Weight | 490.93 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | methyl 4-[5-[(Z)-3-[[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(/C=C(/C#N)C(=O)Nc3nnc(-c4ccccc4Cl)s3)o2)cc1 |
| InChI | InChI=1S/C24H15ClN4O4S/c1-32-23(31)15-8-6-14(7-9-15)20-11-10-17(33-20)12-16(13-26)21(30)27-24-29-28-22(34-24)18-4-2-3-5-19(18)25/h2-12H,1H3,(H,27,29,30)/b16-12- |
| InChIKey | HFFDBYYOMSDGEA-VBKFSLOCSA-N |
| XLogP | 5.45 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.93 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|