C29H23Cl2N3O4S — CID 3311808
butyl 4-[5-[2-cyano-3-[[5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 3311808) has the molecular formula C29H23Cl2N3O4S and a molecular weight of 580.49 g/mol. Its IUPAC name is butyl 4-[5-[2-cyano-3-[[5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | butyl 4-[5-[2-cyano-3-[[5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 3311808 |
| Molecular Formula | C29H23Cl2N3O4S |
| Molecular Weight | 580.49 g/mol |
| Exact Mass | 579.08 |
| IUPAC Name | butyl 4-[5-[2-cyano-3-[[5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(-c2ccc(C=C(C#N)C(=O)Nc3ncc(Cc4cccc(Cl)c4Cl)s3)o2)cc1 |
| InChI | InChI=1S/C29H23Cl2N3O4S/c1-2-3-13-37-28(36)19-9-7-18(8-10-19)25-12-11-22(38-25)14-21(16-32)27(35)34-29-33-17-23(39-29)15-20-5-4-6-24(30)26(20)31/h4-12,14,17H,2-3,13,15H2,1H3,(H,33,34,35) |
| InChIKey | ZITGLCWKNZLQIX-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.49 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|