C31H23N3O4S — CID 3317592
ethyl 4-[5-[2-cyano-3-[[5-(naphthalen-1-ylmethyl)-1,3-thiazol-2-yl]amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 3317592) has the molecular formula C31H23N3O4S and a molecular weight of 533.61 g/mol. Its IUPAC name is ethyl 4-[5-[2-cyano-3-[[5-(naphthalen-1-ylmethyl)-1,3-thiazol-2-yl]amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[2-cyano-3-[[5-(naphthalen-1-ylmethyl)-1,3-thiazol-2-yl]amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 3317592 |
| Molecular Formula | C31H23N3O4S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | ethyl 4-[5-[2-cyano-3-[[5-(naphthalen-1-ylmethyl)-1,3-thiazol-2-yl]amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=C(C#N)C(=O)Nc3ncc(Cc4cccc5ccccc45)s3)o2)cc1 |
| InChI | InChI=1S/C31H23N3O4S/c1-2-37-30(36)22-12-10-21(11-13-22)28-15-14-25(38-28)16-24(18-32)29(35)34-31-33-19-26(39-31)17-23-8-5-7-20-6-3-4-9-27(20)23/h3-16,19H,2,17H2,1H3,(H,33,34,35) |
| InChIKey | ZMQBGZAVDREILF-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|