C20H16N4O6S2 — CID 170910171
ethyl 3-[5-[(Z)-2-cyano-3-[(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 170910171) has the molecular formula C20H16N4O6S2 and a molecular weight of 472.50 g/mol. Its IUPAC name is ethyl 3-[5-[(Z)-2-cyano-3-[(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | ethyl 3-[5-[(Z)-2-cyano-3-[(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 170910171 |
| Molecular Formula | C20H16N4O6S2 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | ethyl 3-[5-[(Z)-2-cyano-3-[(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2ccc(/C=C(/C#N)C(=O)Nc3nc(S(C)(=O)=O)ns3)o2)c1 |
| InChI | InChI=1S/C20H16N4O6S2/c1-3-29-18(26)13-6-4-5-12(9-13)16-8-7-15(30-16)10-14(11-21)17(25)22-19-23-20(24-31-19)32(2,27)28/h4-10H,3H2,1-2H3,(H,22,23,24,25)/b14-10- |
| InChIKey | BHVFUXQJNMAQAZ-UVTDQMKNSA-N |
| XLogP | 2.92 |
| TPSA | 152.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|