C18H13N5O6S2 — CID 170910472
(Z)-2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 170910472) has the molecular formula C18H13N5O6S2 and a molecular weight of 459.47 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170910472 |
| Molecular Formula | C18H13N5O6S2 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | (Z)-2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CCS(=O)(=O)c1nsc(NC(=O)/C(C#N)=C\c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)n1 |
| InChI | InChI=1S/C18H13N5O6S2/c1-2-31(27,28)18-21-17(30-22-18)20-16(24)12(10-19)9-14-7-8-15(29-14)11-3-5-13(6-4-11)23(25)26/h3-9H,2H2,1H3,(H,20,21,22,24)/b12-9- |
| InChIKey | DWIMDGVGVRIRRK-XFXZXTDPSA-N |
| XLogP | 3.05 |
| TPSA | 169.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|