C18H13ClN4O2S2 — CID 170916158
(Z)-3-[5-(4-chlorophenyl)furan-2-yl]-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170916158) has the molecular formula C18H13ClN4O2S2 and a molecular weight of 416.92 g/mol. Its IUPAC name is (Z)-3-[5-(4-chlorophenyl)furan-2-yl]-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-3-[5-(4-chlorophenyl)furan-2-yl]-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170916158 |
| Molecular Formula | C18H13ClN4O2S2 |
| Molecular Weight | 416.92 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | (Z)-3-[5-(4-chlorophenyl)furan-2-yl]-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CCSc1nsc(NC(=O)/C(C#N)=C\c2ccc(-c3ccc(Cl)cc3)o2)n1 |
| InChI | InChI=1S/C18H13ClN4O2S2/c1-2-26-18-22-17(27-23-18)21-16(24)12(10-20)9-14-7-8-15(25-14)11-3-5-13(19)6-4-11/h3-9H,2H2,1H3,(H,21,22,23,24)/b12-9- |
| InChIKey | OXGKWEMEBZPCSJ-XFXZXTDPSA-N |
| XLogP | 5.11 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.92 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|