C18H14N4OS2 — CID 170916977
(E)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-naphthalen-1-ylprop-2-enamide (PubChem CID 170916977) has the molecular formula C18H14N4OS2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 170916977 |
| Molecular Formula | C18H14N4OS2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (E)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-naphthalen-1-ylprop-2-enamide |
| SMILES | CCSc1nsc(NC(=O)/C(C#N)=C/c2cccc3ccccc23)n1 |
| InChI | InChI=1S/C18H14N4OS2/c1-2-24-18-21-17(25-22-18)20-16(23)14(11-19)10-13-8-5-7-12-6-3-4-9-15(12)13/h3-10H,2H2,1H3,(H,20,21,22,23)/b14-10+ |
| InChIKey | JIHYAYGEWUGXFQ-GXDHUFHOSA-N |
| XLogP | 4.35 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|