C24H17ClN4O2S3 — CID 171333578
N-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[5-[(4-chlorophenyl)methylsulfanyl]furan-2-yl]-2-cyanoprop-2-enamide (PubChem CID 171333578) has the molecular formula C24H17ClN4O2S3 and a molecular weight of 525.08 g/mol. Its IUPAC name is N-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[5-[(4-chlorophenyl)methylsulfanyl]furan-2-yl]-2-cyanoprop-2-enamide.
| Compound Name | N-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[5-[(4-chlorophenyl)methylsulfanyl]furan-2-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 171333578 |
| Molecular Formula | C24H17ClN4O2S3 |
| Molecular Weight | 525.08 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | N-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[5-[(4-chlorophenyl)methylsulfanyl]furan-2-yl]-2-cyanoprop-2-enamide |
| SMILES | N#CC(=Cc1ccc(SCc2ccc(Cl)cc2)o1)C(=O)Nc1nc(SCc2ccccc2)ns1 |
| InChI | InChI=1S/C24H17ClN4O2S3/c25-19-8-6-17(7-9-19)14-32-21-11-10-20(31-21)12-18(13-26)22(30)27-23-28-24(29-34-23)33-15-16-4-2-1-3-5-16/h1-12H,14-15H2,(H,27,28,29,30) |
| InChIKey | YHCVJXZVVCPJQS-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.08 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|