C27H25N5O2S2 — CID 170913358
(Z)-N-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-2-cyano-3-[1-[3-(3-methylphenoxy)propyl]pyrrol-2-yl]prop-2-enamide (PubChem CID 170913358) has the molecular formula C27H25N5O2S2 and a molecular weight of 515.66 g/mol. Its IUPAC name is (Z)-N-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-2-cyano-3-[1-[3-(3-methylphenoxy)propyl]pyrrol-2-yl]prop-2-enamide.
| Compound Name | (Z)-N-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-2-cyano-3-[1-[3-(3-methylphenoxy)propyl]pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170913358 |
| Molecular Formula | C27H25N5O2S2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | (Z)-N-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-2-cyano-3-[1-[3-(3-methylphenoxy)propyl]pyrrol-2-yl]prop-2-enamide |
| SMILES | Cc1cccc(OCCCn2cccc2/C=C(/C#N)C(=O)Nc2nc(SCc3ccccc3)ns2)c1 |
| InChI | InChI=1S/C27H25N5O2S2/c1-20-8-5-12-24(16-20)34-15-7-14-32-13-6-11-23(32)17-22(18-28)25(33)29-26-30-27(31-36-26)35-19-21-9-3-2-4-10-21/h2-6,8-13,16-17H,7,14-15,19H2,1H3,(H,29,30,31,33)/b22-17- |
| InChIKey | BAEUYDIDKJGIJM-XLNRJJMWSA-N |
| XLogP | 5.96 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|