C24H26N6O2S — CID 170911237
(Z)-2-cyano-3-[1-[2-(3,4-dimethylphenoxy)ethyl]pyrrol-2-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170911237) has the molecular formula C24H26N6O2S and a molecular weight of 462.58 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[2-(3,4-dimethylphenoxy)ethyl]pyrrol-2-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[2-(3,4-dimethylphenoxy)ethyl]pyrrol-2-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170911237 |
| Molecular Formula | C24H26N6O2S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (Z)-2-cyano-3-[1-[2-(3,4-dimethylphenoxy)ethyl]pyrrol-2-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(OCCn2cccc2/C=C(/C#N)C(=O)Nc2nnc(N3CCCC3)s2)cc1C |
| InChI | InChI=1S/C24H26N6O2S/c1-17-7-8-21(14-18(17)2)32-13-12-29-11-5-6-20(29)15-19(16-25)22(31)26-23-27-28-24(33-23)30-9-3-4-10-30/h5-8,11,14-15H,3-4,9-10,12-13H2,1-2H3,(H,26,27,31)/b19-15- |
| InChIKey | ADWLEEQWIAZFKA-CYVLTUHYSA-N |
| XLogP | 4.18 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|