C21H19FN6OS — CID 170910773
(Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170910773) has the molecular formula C21H19FN6OS and a molecular weight of 422.49 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170910773 |
| Molecular Formula | C21H19FN6OS |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cccn1Cc1ccccc1F)C(=O)Nc1nnc(N2CCCC2)s1 |
| InChI | InChI=1S/C21H19FN6OS/c22-18-8-2-1-6-15(18)14-28-11-5-7-17(28)12-16(13-23)19(29)24-20-25-26-21(30-20)27-9-3-4-10-27/h1-2,5-8,11-12H,3-4,9-10,14H2,(H,24,25,29)/b16-12- |
| InChIKey | DXWXLWWXYDGFDX-VBKFSLOCSA-N |
| XLogP | 3.67 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|