C23H24N6OS — CID 170911073
(Z)-2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170911073) has the molecular formula C23H24N6OS and a molecular weight of 432.55 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170911073 |
| Molecular Formula | C23H24N6OS |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (Z)-2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(-n2c(C)cc(/C=C(/C#N)C(=O)Nc3nnc(N4CCCC4)s3)c2C)cc1 |
| InChI | InChI=1S/C23H24N6OS/c1-15-6-8-20(9-7-15)29-16(2)12-18(17(29)3)13-19(14-24)21(30)25-22-26-27-23(31-22)28-10-4-5-11-28/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,25,26,30)/b19-13- |
| InChIKey | JFBKQGKSXNDOLZ-UYRXBGFRSA-N |
| XLogP | 4.40 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|