C22H20ClFN6O2S — CID 170912561
(Z)-3-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170912561) has the molecular formula C22H20ClFN6O2S and a molecular weight of 486.96 g/mol. Its IUPAC name is (Z)-3-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170912561 |
| Molecular Formula | C22H20ClFN6O2S |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | (Z)-3-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)Nc2nnc(N3CCOCC3)s2)c(C)n1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C22H20ClFN6O2S/c1-13-9-15(14(2)30(13)17-3-4-19(24)18(23)11-17)10-16(12-25)20(31)26-21-27-28-22(33-21)29-5-7-32-8-6-29/h3-4,9-11H,5-8H2,1-2H3,(H,26,27,31)/b16-10- |
| InChIKey | CBZMVHKOYVOZMP-YBEGLDIGSA-N |
| XLogP | 4.12 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|