C20H16ClFN4O2 — CID 170917957
(Z)-3-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide (PubChem CID 170917957) has the molecular formula C20H16ClFN4O2 and a molecular weight of 398.83 g/mol. Its IUPAC name is (Z)-3-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide.
| Compound Name | (Z)-3-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170917957 |
| Molecular Formula | C20H16ClFN4O2 |
| Molecular Weight | 398.83 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (Z)-3-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C(C#N)=C\c2cc(C)n(-c3ccc(F)c(Cl)c3)c2C)no1 |
| InChI | InChI=1S/C20H16ClFN4O2/c1-11-6-14(13(3)26(11)16-4-5-18(22)17(21)9-16)8-15(10-23)20(27)24-19-7-12(2)28-25-19/h4-9H,1-3H3,(H,24,25,27)/b15-8- |
| InChIKey | DRSQOKXXMDGFIC-NVNXTCNLSA-N |
| XLogP | 4.73 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.83 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|