C22H17BrClN3O2 — CID 126374763
(Z)-3-[1-(4-bromo-3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 126374763) has the molecular formula C22H17BrClN3O2 and a molecular weight of 470.75 g/mol. Its IUPAC name is (Z)-3-[1-(4-bromo-3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[1-(4-bromo-3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126374763 |
| Molecular Formula | C22H17BrClN3O2 |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | (Z)-3-[1-(4-bromo-3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)Nc2ccc(O)cc2)c(C)n1-c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C22H17BrClN3O2/c1-13-9-15(14(2)27(13)18-5-8-20(23)21(24)11-18)10-16(12-25)22(29)26-17-3-6-19(28)7-4-17/h3-11,28H,1-2H3,(H,26,29)/b16-10- |
| InChIKey | LPCORDAKYQURSN-YBEGLDIGSA-N |
| XLogP | 5.76 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|