C23H19N3O4 — CID 1494185
(E)-3-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 1494185) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is (E)-3-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1494185 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (E)-3-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)Nc2ccc(O)cc2)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H19N3O4/c1-14-9-16(10-17(12-24)23(28)25-18-3-6-20(27)7-4-18)15(2)26(14)19-5-8-21-22(11-19)30-13-29-21/h3-11,27H,13H2,1-2H3,(H,25,28)/b17-10+ |
| InChIKey | GHWICZXQGAVDGQ-LICLKQGHSA-N |
| XLogP | 4.07 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|