C20H15Cl2N5O2S — CID 170911072
(Z)-2-cyano-3-[5-(3,4-dichlorophenyl)furan-2-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170911072) has the molecular formula C20H15Cl2N5O2S and a molecular weight of 460.35 g/mol. Its IUPAC name is (Z)-2-cyano-3-[5-(3,4-dichlorophenyl)furan-2-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[5-(3,4-dichlorophenyl)furan-2-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170911072 |
| Molecular Formula | C20H15Cl2N5O2S |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | (Z)-2-cyano-3-[5-(3,4-dichlorophenyl)furan-2-yl]-N-(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(-c2ccc(Cl)c(Cl)c2)o1)C(=O)Nc1nnc(N2CCCC2)s1 |
| InChI | InChI=1S/C20H15Cl2N5O2S/c21-15-5-3-12(10-16(15)22)17-6-4-14(29-17)9-13(11-23)18(28)24-19-25-26-20(30-19)27-7-1-2-8-27/h3-6,9-10H,1-2,7-8H2,(H,24,25,28)/b13-9- |
| InChIKey | QCTPDIITMSROIZ-LCYFTJDESA-N |
| XLogP | 5.25 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|