C20H16ClFN4O2S — CID 170918658
(Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[5-(3-chloro-4-fluorophenyl)furan-2-yl]-2-cyanoprop-2-enamide (PubChem CID 170918658) has the molecular formula C20H16ClFN4O2S and a molecular weight of 430.89 g/mol. Its IUPAC name is (Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[5-(3-chloro-4-fluorophenyl)furan-2-yl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[5-(3-chloro-4-fluorophenyl)furan-2-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 170918658 |
| Molecular Formula | C20H16ClFN4O2S |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | (Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[5-(3-chloro-4-fluorophenyl)furan-2-yl]-2-cyanoprop-2-enamide |
| SMILES | CCCCc1nnc(NC(=O)/C(C#N)=C\c2ccc(-c3ccc(F)c(Cl)c3)o2)s1 |
| InChI | InChI=1S/C20H16ClFN4O2S/c1-2-3-4-18-25-26-20(29-18)24-19(27)13(11-23)9-14-6-8-17(28-14)12-5-7-16(22)15(21)10-12/h5-10H,2-4H2,1H3,(H,24,26,27)/b13-9- |
| InChIKey | XOEBLPUKHXDGBP-LCYFTJDESA-N |
| XLogP | 5.48 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|