C26H24N6O3S — CID 171333704
2-cyano-N-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)-3-[1-(2-phenoxyethyl)indol-3-yl]prop-2-enamide (PubChem CID 171333704) has the molecular formula C26H24N6O3S and a molecular weight of 500.58 g/mol. Its IUPAC name is 2-cyano-N-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)-3-[1-(2-phenoxyethyl)indol-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)-3-[1-(2-phenoxyethyl)indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171333704 |
| Molecular Formula | C26H24N6O3S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 2-cyano-N-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)-3-[1-(2-phenoxyethyl)indol-3-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1cn(CCOc2ccccc2)c2ccccc12)C(=O)Nc1nnc(N2CCOCC2)s1 |
| InChI | InChI=1S/C26H24N6O3S/c27-17-19(24(33)28-25-29-30-26(36-25)31-10-13-34-14-11-31)16-20-18-32(23-9-5-4-8-22(20)23)12-15-35-21-6-2-1-3-7-21/h1-9,16,18H,10-15H2,(H,28,29,33) |
| InChIKey | JFSNUNUHTWNXKY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|