C24H24N4O6S2 — CID 171331916
2-cyano-3-[3,5-dimethoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 171331916) has the molecular formula C24H24N4O6S2 and a molecular weight of 528.61 g/mol. Its IUPAC name is 2-cyano-3-[3,5-dimethoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[3,5-dimethoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171331916 |
| Molecular Formula | C24H24N4O6S2 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 2-cyano-3-[3,5-dimethoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | COc1cccc(OCCOc2c(OC)cc(C=C(C#N)C(=O)Nc3nc(SC)ns3)cc2OC)c1 |
| InChI | InChI=1S/C24H24N4O6S2/c1-30-17-6-5-7-18(13-17)33-8-9-34-21-19(31-2)11-15(12-20(21)32-3)10-16(14-25)22(29)26-23-27-24(35-4)28-36-23/h5-7,10-13H,8-9H2,1-4H3,(H,26,27,28,29) |
| InChIKey | HEGJVSSQDJBUAB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 124.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|