C15H14N4O5S3 — CID 170917237
[4-[(Z)-2-cyano-3-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 170917237) has the molecular formula C15H14N4O5S3 and a molecular weight of 426.50 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [4-[(Z)-2-cyano-3-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 170917237 |
| Molecular Formula | C15H14N4O5S3 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | [4-[(Z)-2-cyano-3-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2nc(SC)ns2)ccc1OS(C)(=O)=O |
| InChI | InChI=1S/C15H14N4O5S3/c1-23-12-7-9(4-5-11(12)24-27(3,21)22)6-10(8-16)13(20)17-14-18-15(25-2)19-26-14/h4-7H,1-3H3,(H,17,18,19,20)/b10-6- |
| InChIKey | FCXCYZDLMKTTOJ-POHAHGRESA-N |
| XLogP | 2.15 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|