C20H19N5OS2 — CID 170916976
(Z)-3-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-cyano-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170916976) has the molecular formula C20H19N5OS2 and a molecular weight of 409.54 g/mol. Its IUPAC name is (Z)-3-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-cyano-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-3-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-cyano-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170916976 |
| Molecular Formula | C20H19N5OS2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (Z)-3-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-cyano-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CSc1nsc(NC(=O)/C(C#N)=C\c2cc(C)n(Cc3ccccc3)c2C)n1 |
| InChI | InChI=1S/C20H19N5OS2/c1-13-9-16(14(2)25(13)12-15-7-5-4-6-8-15)10-17(11-21)18(26)22-19-23-20(27-3)24-28-19/h4-10H,12H2,1-3H3,(H,22,23,24,26)/b17-10- |
| InChIKey | FPXBVQINZYFBPW-YVLHZVERSA-N |
| XLogP | 4.27 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|