C18H15N5O4S2 — CID 170916103
(Z)-2-cyano-3-[1-(3-methoxyphenyl)pyrrol-2-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170916103) has the molecular formula C18H15N5O4S2 and a molecular weight of 429.48 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-(3-methoxyphenyl)pyrrol-2-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-(3-methoxyphenyl)pyrrol-2-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170916103 |
| Molecular Formula | C18H15N5O4S2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | (Z)-2-cyano-3-[1-(3-methoxyphenyl)pyrrol-2-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | COc1cccc(-n2cccc2/C=C(/C#N)C(=O)Nc2nc(S(C)(=O)=O)ns2)c1 |
| InChI | InChI=1S/C18H15N5O4S2/c1-27-15-7-3-5-14(10-15)23-8-4-6-13(23)9-12(11-19)16(24)20-17-21-18(22-28-17)29(2,25)26/h3-10H,1-2H3,(H,20,21,22,24)/b12-9- |
| InChIKey | SNYXHXCIQKUTLH-XFXZXTDPSA-N |
| XLogP | 2.29 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|