C23H20N4O6S2 — CID 171332195
[4-[2-cyano-3-[(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] 3-methylbenzoate (PubChem CID 171332195) has the molecular formula C23H20N4O6S2 and a molecular weight of 512.57 g/mol. Its IUPAC name is [4-[2-cyano-3-[(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] 3-methylbenzoate.
| Compound Name | [4-[2-cyano-3-[(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 171332195 |
| Molecular Formula | C23H20N4O6S2 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | [4-[2-cyano-3-[(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] 3-methylbenzoate |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2nc(S(C)(=O)=O)ns2)ccc1OC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C23H20N4O6S2/c1-4-32-19-12-15(8-9-18(19)33-21(29)16-7-5-6-14(2)10-16)11-17(13-24)20(28)25-22-26-23(27-34-22)35(3,30)31/h5-12H,4H2,1-3H3,(H,25,26,27,28) |
| InChIKey | AJIPDGAGJYMYSE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|