C25H26N4O6S2 — CID 171331996
2-cyano-3-[4-[2-(3,4-dimethylphenoxy)ethoxy]-3-ethoxyphenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 171331996) has the molecular formula C25H26N4O6S2 and a molecular weight of 542.64 g/mol. Its IUPAC name is 2-cyano-3-[4-[2-(3,4-dimethylphenoxy)ethoxy]-3-ethoxyphenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[4-[2-(3,4-dimethylphenoxy)ethoxy]-3-ethoxyphenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171331996 |
| Molecular Formula | C25H26N4O6S2 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 2-cyano-3-[4-[2-(3,4-dimethylphenoxy)ethoxy]-3-ethoxyphenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2nc(S(C)(=O)=O)ns2)ccc1OCCOc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C25H26N4O6S2/c1-5-33-22-14-18(7-9-21(22)35-11-10-34-20-8-6-16(2)17(3)12-20)13-19(15-26)23(30)27-24-28-25(29-36-24)37(4,31)32/h6-9,12-14H,5,10-11H2,1-4H3,(H,27,28,29,30) |
| InChIKey | XYAKXKDZMVGSHJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 140.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|