C25H24N4O6S2 — CID 170912469
[4-[(Z)-2-cyano-3-oxo-3-[(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]-2-ethoxyphenyl] 3-methylbenzoate (PubChem CID 170912469) has the molecular formula C25H24N4O6S2 and a molecular weight of 540.62 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-oxo-3-[(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]-2-ethoxyphenyl] 3-methylbenzoate.
| Compound Name | [4-[(Z)-2-cyano-3-oxo-3-[(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]-2-ethoxyphenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 170912469 |
| Molecular Formula | C25H24N4O6S2 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | [4-[(Z)-2-cyano-3-oxo-3-[(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]-2-ethoxyphenyl] 3-methylbenzoate |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2nc(S(=O)(=O)C(C)C)ns2)ccc1OC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C25H24N4O6S2/c1-5-34-21-13-17(9-10-20(21)35-23(31)18-8-6-7-16(4)11-18)12-19(14-26)22(30)27-24-28-25(29-36-24)37(32,33)15(2)3/h6-13,15H,5H2,1-4H3,(H,27,28,29,30)/b19-12- |
| InChIKey | WSMWEWSZEAWFJY-UNOMPAQXSA-N |
| XLogP | 4.19 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|