C24H14Cl2N4O4S — CID 3437496
2-cyano-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3437496) has the molecular formula C24H14Cl2N4O4S and a molecular weight of 525.37 g/mol. Its IUPAC name is 2-cyano-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3437496 |
| Molecular Formula | C24H14Cl2N4O4S |
| Molecular Weight | 525.37 g/mol |
| Exact Mass | 524.01 |
| IUPAC Name | 2-cyano-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2cccc([N+](=O)[O-])c2)o1)C(=O)Nc1ncc(Cc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C24H14Cl2N4O4S/c25-17-5-4-14(21(26)11-17)10-20-13-28-24(35-20)29-23(31)16(12-27)9-19-6-7-22(34-19)15-2-1-3-18(8-15)30(32)33/h1-9,11,13H,10H2,(H,28,29,31) |
| InChIKey | BFEYAGMUGFPWQN-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.37 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|