C28H17Cl2N3OS — CID 6173447
(E)-3-anthracen-9-yl-2-cyano-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 6173447) has the molecular formula C28H17Cl2N3OS and a molecular weight of 514.44 g/mol. Its IUPAC name is (E)-3-anthracen-9-yl-2-cyano-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-anthracen-9-yl-2-cyano-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6173447 |
| Molecular Formula | C28H17Cl2N3OS |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | (E)-3-anthracen-9-yl-2-cyano-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1c2ccccc2cc2ccccc12)C(=O)Nc1ncc(Cc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C28H17Cl2N3OS/c29-21-10-9-19(26(30)14-21)12-22-16-32-28(35-22)33-27(34)20(15-31)13-25-23-7-3-1-5-17(23)11-18-6-2-4-8-24(18)25/h1-11,13-14,16H,12H2,(H,32,33,34)/b20-13+ |
| InChIKey | ZEPKWSWZMFJSQT-DEDYPNTBSA-N |
| XLogP | 7.89 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|