C26H17ClN2O4S — CID 17381031
methyl 2-[[(E)-3-[5-(2-chlorophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-5-phenylthiophene-3-carboxylate (PubChem CID 17381031) has the molecular formula C26H17ClN2O4S and a molecular weight of 488.95 g/mol. Its IUPAC name is methyl 2-[[(E)-3-[5-(2-chlorophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[(E)-3-[5-(2-chlorophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17381031 |
| Molecular Formula | C26H17ClN2O4S |
| Molecular Weight | 488.95 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | methyl 2-[[(E)-3-[5-(2-chlorophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-5-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)sc1NC(=O)/C(C#N)=C/c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C26H17ClN2O4S/c1-32-26(31)20-14-23(16-7-3-2-4-8-16)34-25(20)29-24(30)17(15-28)13-18-11-12-22(33-18)19-9-5-6-10-21(19)27/h2-14H,1H3,(H,29,30)/b17-13+ |
| InChIKey | NDYGBGBHXNIBGW-GHRIWEEISA-N |
| XLogP | 6.66 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.95 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|