C22H11ClF6N2O2 — CID 18863893
(E)-N-[3,5-bis(trifluoromethyl)phenyl]-3-[5-(2-chlorophenyl)furan-2-yl]-2-cyanoprop-2-enamide (PubChem CID 18863893) has the molecular formula C22H11ClF6N2O2 and a molecular weight of 484.78 g/mol. Its IUPAC name is (E)-N-[3,5-bis(trifluoromethyl)phenyl]-3-[5-(2-chlorophenyl)furan-2-yl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-[3,5-bis(trifluoromethyl)phenyl]-3-[5-(2-chlorophenyl)furan-2-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 18863893 |
| Molecular Formula | C22H11ClF6N2O2 |
| Molecular Weight | 484.78 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | (E)-N-[3,5-bis(trifluoromethyl)phenyl]-3-[5-(2-chlorophenyl)furan-2-yl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(-c2ccccc2Cl)o1)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H11ClF6N2O2/c23-18-4-2-1-3-17(18)19-6-5-16(33-19)7-12(11-30)20(32)31-15-9-13(21(24,25)26)8-14(10-15)22(27,28)29/h1-10H,(H,31,32)/b12-7+ |
| InChIKey | FTBSHNUUANOUBR-KPKJPENVSA-N |
| XLogP | 7.18 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.78 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|