C23H14ClF3N2O4 — CID 18863848
methyl 2-[[(E)-3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 18863848) has the molecular formula C23H14ClF3N2O4 and a molecular weight of 474.82 g/mol. Its IUPAC name is methyl 2-[[(E)-3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | methyl 2-[[(E)-3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 18863848 |
| Molecular Formula | C23H14ClF3N2O4 |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | methyl 2-[[(E)-3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)/C(C#N)=C/c1ccc(-c2cc(C(F)(F)F)ccc2Cl)o1 |
| InChI | InChI=1S/C23H14ClF3N2O4/c1-32-22(31)16-4-2-3-5-19(16)29-21(30)13(12-28)10-15-7-9-20(33-15)17-11-14(23(25,26)27)6-8-18(17)24/h2-11H,1H3,(H,29,30)/b13-10+ |
| InChIKey | CGXWUBVIFCTKND-JLHYYAGUSA-N |
| XLogP | 5.95 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|