C21H21N5O4S2 — CID 171332999
2-cyano-N-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)-3-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide (PubChem CID 171332999) has the molecular formula C21H21N5O4S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-cyano-N-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)-3-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)-3-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171332999 |
| Molecular Formula | C21H21N5O4S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 2-cyano-N-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)-3-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
| SMILES | CCS(=O)(=O)c1nnc(NC(=O)C(C#N)=Cc2cc(C)n(-c3cccc(OC)c3)c2C)s1 |
| InChI | InChI=1S/C21H21N5O4S2/c1-5-32(28,29)21-25-24-20(31-21)23-19(27)16(12-22)10-15-9-13(2)26(14(15)3)17-7-6-8-18(11-17)30-4/h6-11H,5H2,1-4H3,(H,23,24,27) |
| InChIKey | KSBBYPFCEVKYMR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|