C22H23N5O5S2 — CID 171332452
2-cyano-3-[1-(2,4-dimethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 171332452) has the molecular formula C22H23N5O5S2 and a molecular weight of 501.59 g/mol. Its IUPAC name is 2-cyano-3-[1-(2,4-dimethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[1-(2,4-dimethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171332452 |
| Molecular Formula | C22H23N5O5S2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 2-cyano-3-[1-(2,4-dimethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CCS(=O)(=O)c1nsc(NC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(OC)cc3OC)c2C)n1 |
| InChI | InChI=1S/C22H23N5O5S2/c1-6-34(29,30)22-25-21(33-26-22)24-20(28)16(12-23)10-15-9-13(2)27(14(15)3)18-8-7-17(31-4)11-19(18)32-5/h7-11H,6H2,1-5H3,(H,24,25,26,28) |
| InChIKey | CVZPWEBLGNROPP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|