C23H25N5O4S2 — CID 171332625
2-cyano-3-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 171332625) has the molecular formula C23H25N5O4S2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 2-cyano-3-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171332625 |
| Molecular Formula | C23H25N5O4S2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 2-cyano-3-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CCOc1ccc(-n2c(C)cc(C=C(C#N)C(=O)Nc3nc(S(=O)(=O)C(C)C)ns3)c2C)cc1 |
| InChI | InChI=1S/C23H25N5O4S2/c1-6-32-20-9-7-19(8-10-20)28-15(4)11-17(16(28)5)12-18(13-24)21(29)25-22-26-23(27-33-22)34(30,31)14(2)3/h7-12,14H,6H2,1-5H3,(H,25,26,27,29) |
| InChIKey | IIEDVXYSHHFEAY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|