C22H22N6O5S2 — CID 171332628
2-cyano-3-[2,5-dimethyl-1-(2-methyl-5-nitrophenyl)pyrrol-3-yl]-N-(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 171332628) has the molecular formula C22H22N6O5S2 and a molecular weight of 514.59 g/mol. Its IUPAC name is 2-cyano-3-[2,5-dimethyl-1-(2-methyl-5-nitrophenyl)pyrrol-3-yl]-N-(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[2,5-dimethyl-1-(2-methyl-5-nitrophenyl)pyrrol-3-yl]-N-(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171332628 |
| Molecular Formula | C22H22N6O5S2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 2-cyano-3-[2,5-dimethyl-1-(2-methyl-5-nitrophenyl)pyrrol-3-yl]-N-(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-n1c(C)cc(C=C(C#N)C(=O)Nc2nc(S(=O)(=O)C(C)C)ns2)c1C |
| InChI | InChI=1S/C22H22N6O5S2/c1-12(2)35(32,33)22-25-21(34-26-22)24-20(29)17(11-23)9-16-8-14(4)27(15(16)5)19-10-18(28(30)31)7-6-13(19)3/h6-10,12H,1-5H3,(H,24,25,26,29) |
| InChIKey | CHXJLFSJYMGFDK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|