C13H11BrN4O4S2 — CID 170912000
(Z)-3-(5-bromofuran-2-yl)-2-cyano-N-(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170912000) has the molecular formula C13H11BrN4O4S2 and a molecular weight of 431.29 g/mol. Its IUPAC name is (Z)-3-(5-bromofuran-2-yl)-2-cyano-N-(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-3-(5-bromofuran-2-yl)-2-cyano-N-(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170912000 |
| Molecular Formula | C13H11BrN4O4S2 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 429.94 |
| IUPAC Name | (Z)-3-(5-bromofuran-2-yl)-2-cyano-N-(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CC(C)S(=O)(=O)c1nsc(NC(=O)/C(C#N)=C\c2ccc(Br)o2)n1 |
| InChI | InChI=1S/C13H11BrN4O4S2/c1-7(2)24(20,21)13-17-12(23-18-13)16-11(19)8(6-15)5-9-3-4-10(14)22-9/h3-5,7H,1-2H3,(H,16,17,18,19)/b8-5- |
| InChIKey | KUOPLWVLNKFECL-YVMONPNESA-N |
| XLogP | 2.62 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|