C20H16N4O5S3 — CID 170912080
[4-[(Z)-2-cyano-3-oxo-3-[(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]phenyl] thiophene-2-carboxylate (PubChem CID 170912080) has the molecular formula C20H16N4O5S3 and a molecular weight of 488.57 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-oxo-3-[(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(Z)-2-cyano-3-oxo-3-[(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 170912080 |
| Molecular Formula | C20H16N4O5S3 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | [4-[(Z)-2-cyano-3-oxo-3-[(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]phenyl] thiophene-2-carboxylate |
| SMILES | CC(C)S(=O)(=O)c1nsc(NC(=O)/C(C#N)=C\c2ccc(OC(=O)c3cccs3)cc2)n1 |
| InChI | InChI=1S/C20H16N4O5S3/c1-12(2)32(27,28)20-23-19(31-24-20)22-17(25)14(11-21)10-13-5-7-15(8-6-13)29-18(26)16-4-3-9-30-16/h3-10,12H,1-2H3,(H,22,23,24,25)/b14-10- |
| InChIKey | HIEQNZVIFMFXFD-UVTDQMKNSA-N |
| XLogP | 3.55 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|