C20H18ClN5O3S2 — CID 171332283
3-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 171332283) has the molecular formula C20H18ClN5O3S2 and a molecular weight of 475.98 g/mol. Its IUPAC name is 3-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | 3-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171332283 |
| Molecular Formula | C20H18ClN5O3S2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 3-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | Cc1ccc(Cl)cc1-n1c(C)cc(C=C(C#N)C(=O)Nc2nc(S(C)(=O)=O)ns2)c1C |
| InChI | InChI=1S/C20H18ClN5O3S2/c1-11-5-6-16(21)9-17(11)26-12(2)7-14(13(26)3)8-15(10-22)18(27)23-19-24-20(25-30-19)31(4,28)29/h5-9H,1-4H3,(H,23,24,25,27) |
| InChIKey | IVUILOWDIGJNAV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|