C19H15Cl2N5O3S2 — CID 170910465
(Z)-2-cyano-3-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170910465) has the molecular formula C19H15Cl2N5O3S2 and a molecular weight of 496.40 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170910465 |
| Molecular Formula | C19H15Cl2N5O3S2 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | (Z)-2-cyano-3-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)Nc2nc(S(C)(=O)=O)ns2)c(C)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl2N5O3S2/c1-10-6-12(11(2)26(10)16-5-4-14(20)8-15(16)21)7-13(9-22)17(27)23-18-24-19(25-30-18)31(3,28)29/h4-8H,1-3H3,(H,23,24,25,27)/b13-7- |
| InChIKey | TXAONNHQVYRTPZ-QPEQYQDCSA-N |
| XLogP | 4.20 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|