C19H22N4O2S2 — CID 170918698
(Z)-2-cyano-3-(5-cyclohexylsulfanylfuran-2-yl)-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170918698) has the molecular formula C19H22N4O2S2 and a molecular weight of 402.55 g/mol. Its IUPAC name is (Z)-2-cyano-3-(5-cyclohexylsulfanylfuran-2-yl)-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(5-cyclohexylsulfanylfuran-2-yl)-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170918698 |
| Molecular Formula | C19H22N4O2S2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (Z)-2-cyano-3-(5-cyclohexylsulfanylfuran-2-yl)-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CC(C)c1nnc(NC(=O)/C(C#N)=C\c2ccc(SC3CCCCC3)o2)s1 |
| InChI | InChI=1S/C19H22N4O2S2/c1-12(2)18-22-23-19(27-18)21-17(24)13(11-20)10-14-8-9-16(25-14)26-15-6-4-3-5-7-15/h8-10,12,15H,3-7H2,1-2H3,(H,21,23,24)/b13-10- |
| InChIKey | PIAPBFCKOAAXEY-RAXLEYEMSA-N |
| XLogP | 5.22 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|