C25H26N4O2S2 — CID 170918465
(Z)-2-cyano-3-(5-cyclohexylsulfanylfuran-2-yl)-N-[5-(1-phenylpropyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 170918465) has the molecular formula C25H26N4O2S2 and a molecular weight of 478.64 g/mol. Its IUPAC name is (Z)-2-cyano-3-(5-cyclohexylsulfanylfuran-2-yl)-N-[5-(1-phenylpropyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(5-cyclohexylsulfanylfuran-2-yl)-N-[5-(1-phenylpropyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170918465 |
| Molecular Formula | C25H26N4O2S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | (Z)-2-cyano-3-(5-cyclohexylsulfanylfuran-2-yl)-N-[5-(1-phenylpropyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | CCC(c1ccccc1)c1nnc(NC(=O)/C(C#N)=C\c2ccc(SC3CCCCC3)o2)s1 |
| InChI | InChI=1S/C25H26N4O2S2/c1-2-21(17-9-5-3-6-10-17)24-28-29-25(33-24)27-23(30)18(16-26)15-19-13-14-22(31-19)32-20-11-7-4-8-12-20/h3,5-6,9-10,13-15,20-21H,2,4,7-8,11-12H2,1H3,(H,27,29,30)/b18-15- |
| InChIKey | VXYPUJINUNKGKZ-SDXDJHTJSA-N |
| XLogP | 6.64 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|