C20H18N4O3S2 — CID 170918690
(Z)-2-cyano-3-(5-cyclohexylsulfanylfuran-2-yl)-N-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 170918690) has the molecular formula C20H18N4O3S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is (Z)-2-cyano-3-(5-cyclohexylsulfanylfuran-2-yl)-N-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(5-cyclohexylsulfanylfuran-2-yl)-N-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170918690 |
| Molecular Formula | C20H18N4O3S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | (Z)-2-cyano-3-(5-cyclohexylsulfanylfuran-2-yl)-N-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(SC2CCCCC2)o1)C(=O)Nc1nnc(-c2ccco2)s1 |
| InChI | InChI=1S/C20H18N4O3S2/c21-12-13(11-14-8-9-17(27-14)28-15-5-2-1-3-6-15)18(25)22-20-24-23-19(29-20)16-7-4-10-26-16/h4,7-11,15H,1-3,5-6H2,(H,22,24,25)/b13-11- |
| InChIKey | MFEGHIZPTCILDZ-QBFSEMIESA-N |
| XLogP | 5.36 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|