C21H14ClN5O3S — CID 170915210
(Z)-3-[1-(5-chloro-2-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 170915210) has the molecular formula C21H14ClN5O3S and a molecular weight of 451.90 g/mol. Its IUPAC name is (Z)-3-[1-(5-chloro-2-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (Z)-3-[1-(5-chloro-2-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170915210 |
| Molecular Formula | C21H14ClN5O3S |
| Molecular Weight | 451.90 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | (Z)-3-[1-(5-chloro-2-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1-n1cccc1/C=C(/C#N)C(=O)Nc1nnc(-c2ccco2)s1 |
| InChI | InChI=1S/C21H14ClN5O3S/c1-29-17-7-6-14(22)11-16(17)27-8-2-4-15(27)10-13(12-23)19(28)24-21-26-25-20(31-21)18-5-3-9-30-18/h2-11H,1H3,(H,24,26,28)/b13-10- |
| InChIKey | LJTJXVMGZSOKAF-RAXLEYEMSA-N |
| XLogP | 4.80 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.90 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|