C25H20ClN5O3S — CID 171333136
3-[1-(5-chloro-2-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-[5-[(2-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 171333136) has the molecular formula C25H20ClN5O3S and a molecular weight of 505.99 g/mol. Its IUPAC name is 3-[1-(5-chloro-2-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-[5-[(2-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | 3-[1-(5-chloro-2-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-[5-[(2-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171333136 |
| Molecular Formula | C25H20ClN5O3S |
| Molecular Weight | 505.99 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 3-[1-(5-chloro-2-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-[5-[(2-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1-n1cccc1C=C(C#N)C(=O)Nc1nnc(COc2ccccc2C)s1 |
| InChI | InChI=1S/C25H20ClN5O3S/c1-16-6-3-4-8-21(16)34-15-23-29-30-25(35-23)28-24(32)17(14-27)12-19-7-5-11-31(19)20-13-18(26)9-10-22(20)33-2/h3-13H,15H2,1-2H3,(H,28,30,32) |
| InChIKey | RLOMQRHUXAZMDW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.99 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|