C23H16ClN5OS — CID 170915504
(Z)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-[1-(4-chlorophenyl)pyrrol-2-yl]-2-cyanoprop-2-enamide (PubChem CID 170915504) has the molecular formula C23H16ClN5OS and a molecular weight of 445.94 g/mol. Its IUPAC name is (Z)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-[1-(4-chlorophenyl)pyrrol-2-yl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-[1-(4-chlorophenyl)pyrrol-2-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 170915504 |
| Molecular Formula | C23H16ClN5OS |
| Molecular Weight | 445.94 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | (Z)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-[1-(4-chlorophenyl)pyrrol-2-yl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/c1cccn1-c1ccc(Cl)cc1)C(=O)Nc1nnc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C23H16ClN5OS/c24-18-8-10-19(11-9-18)29-12-4-7-20(29)14-17(15-25)22(30)26-23-28-27-21(31-23)13-16-5-2-1-3-6-16/h1-12,14H,13H2,(H,26,28,30)/b17-14- |
| InChIKey | KVGVFUJCNXWFTF-VKAVYKQESA-N |
| XLogP | 5.12 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.94 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|