C22H13ClF3N5OS2 — CID 170915086
(Z)-3-[1-[2-chloro-5-(trifluoromethyl)phenyl]pyrrol-2-yl]-2-cyano-N-[5-(thiophen-2-ylmethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 170915086) has the molecular formula C22H13ClF3N5OS2 and a molecular weight of 519.96 g/mol. Its IUPAC name is (Z)-3-[1-[2-chloro-5-(trifluoromethyl)phenyl]pyrrol-2-yl]-2-cyano-N-[5-(thiophen-2-ylmethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (Z)-3-[1-[2-chloro-5-(trifluoromethyl)phenyl]pyrrol-2-yl]-2-cyano-N-[5-(thiophen-2-ylmethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170915086 |
| Molecular Formula | C22H13ClF3N5OS2 |
| Molecular Weight | 519.96 g/mol |
| Exact Mass | 519.02 |
| IUPAC Name | (Z)-3-[1-[2-chloro-5-(trifluoromethyl)phenyl]pyrrol-2-yl]-2-cyano-N-[5-(thiophen-2-ylmethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cccn1-c1cc(C(F)(F)F)ccc1Cl)C(=O)Nc1nnc(Cc2cccs2)s1 |
| InChI | InChI=1S/C22H13ClF3N5OS2/c23-17-6-5-14(22(24,25)26)10-18(17)31-7-1-3-15(31)9-13(12-27)20(32)28-21-30-29-19(34-21)11-16-4-2-8-33-16/h1-10H,11H2,(H,28,30,32)/b13-9- |
| InChIKey | NNPJZIGFEBCQBR-LCYFTJDESA-N |
| XLogP | 6.20 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.96 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|