C25H21N5O2S — CID 170915081
(Z)-2-cyano-N-[5-[(2-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]-3-[1-(4-methylphenyl)pyrrol-2-yl]prop-2-enamide (PubChem CID 170915081) has the molecular formula C25H21N5O2S and a molecular weight of 455.54 g/mol. Its IUPAC name is (Z)-2-cyano-N-[5-[(2-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]-3-[1-(4-methylphenyl)pyrrol-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[5-[(2-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]-3-[1-(4-methylphenyl)pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170915081 |
| Molecular Formula | C25H21N5O2S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (Z)-2-cyano-N-[5-[(2-methylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]-3-[1-(4-methylphenyl)pyrrol-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(-n2cccc2/C=C(/C#N)C(=O)Nc2nnc(COc3ccccc3C)s2)cc1 |
| InChI | InChI=1S/C25H21N5O2S/c1-17-9-11-20(12-10-17)30-13-5-7-21(30)14-19(15-26)24(31)27-25-29-28-23(33-25)16-32-22-8-4-3-6-18(22)2/h3-14H,16H2,1-2H3,(H,27,29,31)/b19-14- |
| InChIKey | XKMKVBWQSPLCRC-RGEXLXHISA-N |
| XLogP | 5.07 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|